Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-(4-(Trifluoromethyl)phenyl)-1H-pyrrole-2,5-dione
For research use only. Not for therapeutic Use.
1-(4-(Trifluoromethyl)phenyl)-1H-pyrrole-2,5-dione (Cat.No:L003575) is a significant chemical compound with wide-ranging applications in medicinal chemistry. Its unique structure, featuring a trifluoromethylphenyl group, imparts valuable pharmacological properties. This compound serves as a crucial scaffold in the development of pharmaceutical agents, particularly in the quest for innovative treatments.
CAS Number | 54647-09-5 |
Molecular Formula | C11H6F3NO2 |
Purity | ≥95% |
IUPAC Name | 1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
InChI | InChI=1S/C11H6F3NO2/c12-11(13,14)7-1-3-8(4-2-7)15-9(16)5-6-10(15)17/h1-6H |
InChIKey | RFSCHBMMSVGJAY-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(F)(F)F)N2C(=O)C=CC2=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |