For research use only. Not for therapeutic Use.
1-(4-(Trifluoromethyl)pyridin-3-yl)ethanone is an aromatic ketone featuring a trifluoromethyl-substituted pyridine ring attached to an ethanone moiety. This compound is valuable in organic synthesis and medicinal chemistry, particularly as an intermediate in the development of pharmaceuticals and agrochemicals. The trifluoromethyl group enhances the compound’s lipophilicity and metabolic stability, making it attractive for drug design. Its unique structure allows for further functionalization, facilitating the creation of novel compounds with potential biological activities and applications in various chemical research fields.
CAS Number | 955997-27-0 |
Molecular Formula | C8H6F3NO |
Purity | ≥95% |
IUPAC Name | 1-[4-(trifluoromethyl)pyridin-3-yl]ethanone |
InChI | InChI=1S/C8H6F3NO/c1-5(13)6-4-12-3-2-7(6)8(9,10)11/h2-4H,1H3 |
InChIKey | CLFZUPPNZLYDKP-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C=CN=C1)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |