Home
>
Chemical Reagents>Organometallic Reagents> 1-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole
For research use only. Not for therapeutic Use.
1-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole (Cat.No:L004096) is a crucial compound in materials science. Its unique structure, incorporating a dioxaborolane and carbazole moiety, imparts specialized properties. This compound serves as a valuable intermediate in the synthesis of advanced materials, particularly in the field of organic electronics.
Catalog Number | L004096 |
CAS Number | 1219637-88-3 |
Molecular Formula | C18H20BNO2 |
Purity | ≥95% |
IUPAC Name | 1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole |
InChI | InChI=1S/C18H20BNO2/c1-17(2)18(3,4)22-19(21-17)14-10-7-9-13-12-8-5-6-11-15(12)20-16(13)14/h5-11,20H,1-4H3 |
InChIKey | LJHNBACDLZYSIS-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C4=CC=CC=C4N3 |