For research use only. Not for therapeutic Use.
1-(5-Amino-2-chlorophenyl)ethanone (Cat.No:L003486) is a crucial chemical compound utilized in pharmaceutical research. Its distinctive structure, featuring an amino group and a chlorophenyl moiety, renders it valuable in the synthesis of bioactive compounds. This versatile building block is pivotal in the development of pharmaceutical agents, showcasing its significance in modern drug discovery.
CAS Number | 99914-14-4 |
Molecular Formula | C8H8ClNO |
Purity | ≥95% |
IUPAC Name | 1-(5-amino-2-chlorophenyl)ethanone |
InChI | InChI=1S/C8H8ClNO/c1-5(11)7-4-6(10)2-3-8(7)9/h2-4H,10H2,1H3 |
InChIKey | OFXIFGBYOCETDW-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C=CC(=C1)N)Cl |