For research use only. Not for therapeutic Use.
1-(5-Aminoisoxazol-3-yl)ethanone(Cat No.:L022640)is a chemical intermediate notable for its incorporation of an isoxazole ring, which is a key structural motif in pharmaceutical chemistry due to its presence in various bioactive molecules. The 5-amino substitution enhances the compound’s functionality, allowing for nucleophilic attack and further derivatization. The ethanone group adds an additional reactive carbonyl site, facilitating condensation reactions. This compound’s structure and functional groups make it a valuable precursor in the synthesis of heterocyclic compounds, used in the development of drugs with potential anti-inflammatory and antimicrobial properties.
CAS Number | 1558335-05-9 |
Molecular Formula | C5H6N2O2 |
Purity | ≥95% |
IUPAC Name | 1-(5-amino-1,2-oxazol-3-yl)ethanone |
InChI | InChI=1S/C5H6N2O2/c1-3(8)4-2-5(6)9-7-4/h2H,6H2,1H3 |
InChIKey | IFTDJDDDZXDNCX-UHFFFAOYSA-N |
SMILES | CC(=O)C1=NOC(=C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |