For research use only. Not for therapeutic Use.
1-(5-Aminothiazol-2-yl)guanidine hydrochloride(CAT: L019935) is an organic compound that features a guanidine group attached to a 5-aminothiazole ring, with the hydrochloride salt form improving its solubility and stability. This compound is of interest in medicinal chemistry due to the presence of both guanidine and thiazole groups, which are common motifs in bioactive molecules. These functional groups allow for multiple interactions with biological targets, making it useful for drug design and synthesis. The aminothiazole ring often serves as a core scaffold in designing inhibitors, particularly for enzymes like kinases, contributing to therapeutic research in fields such as cancer and infectious diseases.
CAS Number | 1956390-06-9 |
Molecular Formula | C4H8ClN5S |
Purity | ≥95% |
IUPAC Name | 2-(5-amino-1,3-thiazol-2-yl)guanidine;hydrochloride |
InChI | InChI=1S/C4H7N5S.ClH/c5-2-1-8-4(10-2)9-3(6)7;/h1H,5H2,(H4,6,7,8,9);1H |
InChIKey | NAXZQPOZKLRNPQ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |