For research use only. Not for therapeutic Use.
1-(5-Bromopyridin-2-yl)-ethanol(CAT: M041075) is a brominated pyridine-based compound widely used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. This molecule features a bromine atom at the 5-position of the pyridine ring and an ethanol group attached to the 2-position, making it suitable for reactions that introduce further functional groups. The hydroxyl group provides versatility in derivatization, allowing for transformations such as oxidation to aldehydes or ketones or conversion to esters and ethers. Its structure is useful in synthesizing biologically active molecules, where the bromine atom enables cross-coupling reactions, such as Suzuki or Heck couplings. This compound’s design makes it beneficial in constructing complex molecular frameworks for drug discovery and other applications in chemical research.
CAS Number | 159533-68-3 |
Molecular Formula | C7H8BrNO |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 1-(5-bromopyridin-2-yl)ethanol |
InChI | InChI=1S/C7H8BrNO/c1-5(10)7-3-2-6(8)4-9-7/h2-5,10H,1H3 |
InChIKey | MFQDJRTUQSZLOZ-UHFFFAOYSA-N |
SMILES | CC(C1=NC=C(C=C1)Br)O |