Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-((5-Bromopyridin-3-yl)methyl)-4-methylpiperazine
For research use only. Not for therapeutic Use.
1-((5-Bromopyridin-3-yl)methyl)-4-methylpiperazine(Cat No.:L033764)is a heterocyclic compound used in pharmaceutical research and organic synthesis. The molecule features a piperazine ring substituted with a methyl group at the 4-position and a bromopyridinylmethyl group at the nitrogen atom. This structure provides unique reactivity, making it valuable as an intermediate in the synthesis of biologically active molecules, including potential drug candidates. The bromopyridine moiety allows for further functionalization through cross-coupling reactions, while the piperazine ring is commonly found in bioactive compounds, making it essential for drug discovery and medicinal chemistry.
CAS Number | 1160924-36-6 |
Molecular Formula | C11H16BrN3 |
Purity | ≥95% |
IUPAC Name | 1-[(5-bromopyridin-3-yl)methyl]-4-methylpiperazine |
InChI | InChI=1S/C11H16BrN3/c1-14-2-4-15(5-3-14)9-10-6-11(12)8-13-7-10/h6-8H,2-5,9H2,1H3 |
InChIKey | MHLYUHYLQWGTHT-UHFFFAOYSA-N |
SMILES | CN1CCN(CC1)CC2=CC(=CN=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |