Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-(5-Fluoropyridin-2-yl)ethanamine dihydrochloride
For research use only. Not for therapeutic Use.
1-(5-Fluoropyridin-2-yl)ethanamine dihydrochloride (Cat.No:L003487) is a significant compound in pharmaceutical chemistry. Its unique structure, featuring a fluorinated pyridine moiety, lends itself to potential therapeutic applications. This compound serves as a key intermediate in the synthesis of pharmacologically active molecules.
Catalog Number | L003487 |
CAS Number | 1955519-79-5 |
Molecular Formula | C7H11Cl2FN2 |
Purity | ≥95% |
IUPAC Name | 1-(5-fluoropyridin-2-yl)ethanamine;dihydrochloride |
InChI | InChI=1S/C7H9FN2.2ClH/c1-5(9)7-3-2-6(8)4-10-7;;/h2-5H,9H2,1H3;2*1H |
InChIKey | HYHHMRDWSZCHPZ-UHFFFAOYSA-N |
SMILES | CC(C1=NC=C(C=C1)F)N.Cl.Cl |