For research use only. Not for therapeutic Use.
1-(5-Isopropylpyridin-2-yl)ethanone(Cat No.:L020658)is an important organic compound used in pharmaceutical and chemical research. Featuring an isopropyl group attached to a pyridine ring with an ethanone moiety, this compound serves as a key intermediate in the synthesis of various complex molecules, including potential therapeutic agents. Its unique structure allows for diverse chemical modifications, making it valuable in the development of new drugs and fine chemicals. 1-(5-Isopropylpyridin-2-yl)ethanone plays a crucial role in high-precision synthesis, supporting advancements in medicinal chemistry and innovative research.
CAS Number | 137853-21-5 |
Molecular Formula | C10H13NO |
Purity | ≥95% |
IUPAC Name | 1-(5-propan-2-ylpyridin-2-yl)ethanone |
InChI | InChI=1S/C10H13NO/c1-7(2)9-4-5-10(8(3)12)11-6-9/h4-7H,1-3H3 |
InChIKey | VZGGIFJVSKCNLH-UHFFFAOYSA-N |
SMILES | CC(C)C1=CN=C(C=C1)C(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |