For research use only. Not for therapeutic Use.
1-(5-Methylisoxazol-3-yl)ethanone(Cat No.:L020902)is a specialized chemical compound featuring an isoxazole ring substituted with a methyl group and linked to an ethanone group. This structure provides unique electronic properties and reactivity, making it a valuable intermediate in organic synthesis, particularly in the pharmaceutical industry. The isoxazole ring is known for its role in enhancing biological activity, contributing to compounds used in CNS disorders and inflammatory diseases. The ethanone part facilitates further chemical modifications, expanding its utility in creating diverse bioactive molecules. 1-(5-Methylisoxazol-3-yl)ethanone is crucial for developing novel therapeutic agents with improved efficacy.
CAS Number | 24068-54-0 |
Molecular Formula | C6H7NO2 |
Purity | ≥95% |
IUPAC Name | 1-(5-methyl-1,2-oxazol-3-yl)ethanone |
InChI | InChI=1S/C6H7NO2/c1-4-3-6(5(2)8)7-9-4/h3H,1-2H3 |
InChIKey | KYVXYWKQFCSMHL-UHFFFAOYSA-N |
SMILES | CC1=CC(=NO1)C(=O)C |