For research use only. Not for therapeutic Use.
1-(5-Methylthiazol-4-yl)ethanone(CAT: L031792) is a high-purity compound widely used in pharmaceutical and chemical research. Featuring a thiazole ring with a methyl substituent at the 5-position and a ketone group at the 1-position, it serves as a versatile intermediate in the synthesis of bioactive molecules, including drug candidates and agrochemicals. Its reactive ketone functionality allows for diverse chemical modifications, such as condensation and coupling reactions. With consistent performance and reliable quality, 1-(5-Methylthiazol-4-yl)ethanone is a valuable tool for advancing research in medicinal chemistry and organic synthesis.
CAS Number | 1368187-44-3 |
Molecular Formula | C6H7NOS |
Purity | ≥95% |
IUPAC Name | 1-(5-methyl-1,3-thiazol-4-yl)ethanone |
InChI | InChI=1S/C6H7NOS/c1-4(8)6-5(2)9-3-7-6/h3H,1-2H3 |
InChIKey | UFXXGLKLMLAWDQ-UHFFFAOYSA-N |
SMILES | CC1=C(N=CS1)C(=O)C |