1-(6-Acetyl-9H-carbazol-3-yl)-ethanone(CAT: L000006) is a chemical compound of importance in organic chemistry. This compound serves as a crucial building block for the synthesis of various organic compounds, enabling the creation of unique molecules with diverse applications. Its acetyl-carbazole structure provides a versatile platform for the development of specialized organic molecules.
| Catalog Number | L000006 |
| CAS Number | 3403-70-1 |
| Molecular Formula | C16H13NO2 |
| Purity | ≥95% |
| IUPAC Name | 1-(6-acetyl-9H-carbazol-3-yl)ethanone |
| InChI | InChI=1S/C16H13NO2/c1-9(18)11-3-5-15-13(7-11)14-8-12(10(2)19)4-6-16(14)17-15/h3-8,17H,1-2H3 |
| InChIKey | PQLQXNVTTJCZFJ-UHFFFAOYSA-N |
