For research use only. Not for therapeutic Use.
1-(6-Bromo-pyridin-3-yl)ethanone (Cat No.:M111025) is a chemical compound. It features a pyridine ring substituted with a bromine atom and an ethanone group. This compound is of interest in pharmaceutical and synthetic chemistry due to its potential as a versatile building block. Its brominated pyridine moiety can facilitate various reactions, allowing the introduction of specific functional groups. This compound’s reactivity and structural properties make it valuable in creating complex molecules for drug discovery and other chemical applications. Its ability to modify molecular architecture contributes to its role in diverse research endeavors.
CAS Number | 139042-59-4 |
Molecular Formula | C7H6BrNO |
Purity | ≥95% |
Storage | Inert atmosphere,Room Temperature |
IUPAC Name | 1-(6-bromopyridin-3-yl)ethanone |
InChI | InChI=1S/C7H6BrNO/c1-5(10)6-2-3-7(8)9-4-6/h2-4H,1H3 |
InChIKey | MUKKGHQBUKOMTD-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CN=C(C=C1)Br |