For research use only. Not for therapeutic Use.
1-(6-Bromoimidazo[1,2-a]pyridin-3-yl)ethanone(Cat No.:L021446)is a brominated heterocyclic compound widely used in pharmaceutical research and organic synthesis. This molecule features a 6-bromo substituent on the imidazo[1,2-a]pyridine core, coupled with an ethanone group, making it a valuable intermediate for creating bioactive compounds. It is particularly significant in the development of potential therapeutic agents targeting cancer and neurological disorders. The compound’s unique structure and reactivity make 1-(6-Bromoimidazo[1,2-a]pyridin-3-yl)ethanone a crucial building block for medicinal chemists focused on innovative drug discovery and development.
CAS Number | 30493-41-5 |
Molecular Formula | C9H7BrN2O |
Purity | ≥95% |
IUPAC Name | 1-(6-bromoimidazo[1,2-a]pyridin-3-yl)ethanone |
InChI | InChI=1S/C9H7BrN2O/c1-6(13)8-4-11-9-3-2-7(10)5-12(8)9/h2-5H,1H3 |
InChIKey | DDVXKYXTMIQMPV-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CN=C2N1C=C(C=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |