For research use only. Not for therapeutic Use.
1-(6-Chloropyridin-2-yl)ethanone(CAT: M133103) is a chlorinated pyridine ketone that serves as an essential intermediate in organic synthesis, particularly in pharmaceutical research. Its structure, featuring a chlorine atom at the 6-position of the pyridine ring and an ethanone group attached to the 2-position, allows for selective modifications and diverse functionalization, making it a valuable building block. This compound is frequently utilized in the development of bioactive molecules, where the chlorinated pyridine moiety can improve metabolic stability and binding affinity in target compounds. Researchers leverage this compound in drug discovery processes, agrochemical development, and material sciences to create novel entities with potential therapeutic applications.
CAS Number | 152356-57-5 |
Molecular Formula | C7H6ClNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(6-chloropyridin-2-yl)ethanone |
InChI | InChI=1S/C7H6ClNO/c1-5(10)6-3-2-4-7(8)9-6/h2-4H,1H3 |
InChIKey | KFBYRBFYHOJYTG-UHFFFAOYSA-N |
SMILES | CC(=O)C1=NC(=CC=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |