For research use only. Not for therapeutic Use.
(+)-1-(9-Fluorenyl)ethyl chloroformate (Cat No.:M010324) is a chiral chemical compound. Featuring a fluorenyl ring linked to an ethyl chloroformate moiety, this compound is used in organic synthesis and asymmetric transformations. Its chirality enables the creation of enantiopure derivatives, vital in pharmaceutical research and agrochemical production. Serving as a protecting group reagent, it selectively shields amine functionalities. Additionally, it participates in the construction of complex molecules due to its versatile reactivity. The compound’s stereochemistry and functionalization capabilities contribute to its role in producing valuable intermediates and structurally diverse compounds.
Catalog Number | M010324 |
CAS Number | 107474-79-3 |
Molecular Formula | C16H13ClO2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1-(9H-fluoren-9-yl)ethyl carbonochloridate |
InChI | InChI=1S/C16H13ClO2/c1-10(19-16(17)18)15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-10,15H,1H3 |
InChIKey | SFRVOKMRHPQYGE-UHFFFAOYSA-N |
SMILES | CC(C1C2=CC=CC=C2C3=CC=CC=C13)OC(=O)Cl |