Home
>
Reference Standards>ADC-linkers> 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13-tetraoxa-4-azahexadecan-16-oic Acid
For research use only. Not for therapeutic Use.
1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13-tetraoxa-4-azahexadecan-16-oic Acid(CAT: R022422) is a complex organic compound with a unique structure containing a fluorenyl group, a tetraoxa-azahexadecane chain, and a carboxylic acid functional group. Its mode of action and pharmacological effects are not explicitly documented, suggesting it may primarily serve as a chemical intermediate or a building block in various synthetic processes. Compounds like 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13-tetraoxa-4-azahexadecan-16-oic Acid often play roles in organic synthesis for creating more complex molecules for pharmaceuticals, agrochemicals, or other specialized applications.
CAS Number | 867062-95-1 |
Synonyms | 1-(9H-Fluoren-9-ylmethyl) Ester 5,8,11-Trioxa-2-azatetradecanedioic Acid |
Molecular Formula | C24H29NO7 |
Purity | ≥95% |
Target | PROTAC |
Storage | -20°C |
IUPAC Name | 3-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoic acid |
InChI | InChI=1S/C24H29NO7/c26-23(27)9-11-29-13-15-31-16-14-30-12-10-25-24(28)32-17-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-8,22H,9-17H2,(H,25,28)(H,26,27) |
InChIKey | CHIDDYZONKDHLG-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCC(=O)O |