Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-((9H-fluoren-9-yl)methyl)piperidine
For research use only. Not for therapeutic Use.
1-((9H-fluoren-9-yl)methyl)piperidine(CAT: L005307) a piperidine derivative with a 9H-fluoren-9-ylmethyl substituent, holds significance in pharmaceutical and organic chemistry. The fluorenyl group introduces potential interactions with biological targets, making it relevant for drug development. In pharmaceutical research, it could be explored for its effects on enzyme inhibition or receptor interactions, potentially impacting therapeutic pathways. Its piperidine core offers opportunities for chemical modifications, crucial for fine-tuning properties or creating derivatives.
Catalog Number | L005307 |
CAS Number | 35661-58-6 |
Molecular Formula | C19H21N |
Purity | ≥95% |
IUPAC Name | 1-(9H-fluoren-9-ylmethyl)piperidine |
InChI | InChI=1S/C19H21N/c1-6-12-20(13-7-1)14-19-17-10-4-2-8-15(17)16-9-3-5-11-18(16)19/h2-5,8-11,19H,1,6-7,12-14H2 |
InChIKey | DAYKWVVEINTEQW-UHFFFAOYSA-N |