For research use only. Not for therapeutic Use.
1-Acetyl-4-(methylamino)piperidine(Cat No.:L006851), is a chemical compound with applications in medicinal chemistry and drug discovery. Its molecular structure contains a piperidine ring substituted with an acetyl group and a methylamino group. This compound is of interest to researchers due to its potential biological activity, particularly in the development of new drugs targeting various biological pathways. Scientists study its structure-activity relationships to design and create novel pharmaceutical compounds.
CAS Number | 139062-96-7 |
Molecular Formula | C8H16N2O |
Purity | ≥95% |
IUPAC Name | 1-[4-(methylamino)piperidin-1-yl]ethanone |
InChI | InChI=1S/C8H16N2O/c1-7(11)10-5-3-8(9-2)4-6-10/h8-9H,3-6H2,1-2H3 |
InChIKey | RSEPODZAQBVPOS-UHFFFAOYSA-N |
SMILES | CC(=O)N1CCC(CC1)NC |