For research use only. Not for therapeutic Use.
1-Acetyl-4-methylpiperazine hydrochloride(CAT: I010196) plays a significant role in the field of neuropharmacology and receptor modulation research. Functioning as a nicotinic acetylcholine receptor (nAChR) agonist, this compound targets a class of receptors involved in neurotransmission. By binding to and activating nAChRs, 1-Acetyl-4-methylpiperazine hydrochloride has the potential to modulate neuronal signaling and influence various physiological processes. Its specific action on nAChRs underscores its importance in understanding the intricacies of cholinergic neurotransmission and exploring its potential applications in neurological and neuropsychiatric disorders.
CAS Number | 144205-68-5 |
Molecular Formula | C7H15ClN2O |
Purity | ≥95% |
Target | Nicotinic Receptor |
Solubility | Soluble to 50 mM in water |
Storage | Desiccate at RT |
IUPAC Name | 1-(4-methylpiperazin-1-yl)ethanone;hydrochloride |
InChI | InChI=1S/C7H14N2O.ClH/c1-7(10)9-5-3-8(2)4-6-9;/h3-6H2,1-2H3;1H |
InChIKey | MQTVMZTUPOGGGV-UHFFFAOYSA-N |
SMILES | CC(=O)N1CCN(CC1)C.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |