For research use only. Not for therapeutic Use.
1-Acetylindolin-5-ylboronic acid (Cat.No:L003846) is a pivotal compound in medicinal chemistry. Its unique structure, combining an indolinyl moiety with a boronic acid group, provides valuable reactivity. This compound is utilized as a key intermediate in the synthesis of specialized molecules for pharmaceutical research.
CAS Number | 905971-97-3 |
Molecular Formula | C10H12BNO3 |
Purity | ≥95% |
IUPAC Name | (1-acetyl-2,3-dihydroindol-5-yl)boronic acid |
InChI | InChI=1S/C10H12BNO3/c1-7(13)12-5-4-8-6-9(11(14)15)2-3-10(8)12/h2-3,6,14-15H,4-5H2,1H3 |
InChIKey | IERYXDICIURWMB-UHFFFAOYSA-N |
SMILES | B(C1=CC2=C(C=C1)N(CC2)C(=O)C)(O)O |