For research use only. Not for therapeutic Use.
1-Acridinamine(Cat No.:I020756)is an organic compound derived from acridine, characterized by the presence of an amino group (-NH₂) at the 1-position of the acridine ring system. It is primarily studied for its potential biological activities, including antimicrobial, anticancer, or other pharmacological properties. The molecule’s structure allows it to intercalate into DNA, which may contribute to its therapeutic effects or cytotoxicity. 1-Acridinamine and its derivatives have been explored in medicinal chemistry for their ability to interact with cellular DNA and potentially inhibit cell proliferation, making them promising candidates for drug development.
CAS Number | 578-06-3 |
Synonyms | 1-Aminoacridine; 1-Aminoakridin; 1-Acridinamine |
Molecular Formula | C13H10N2 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | acridin-1-amine |
InChI | InChI=1S/C13H10N2/c14-11-5-3-7-13-10(11)8-9-4-1-2-6-12(9)15-13/h1-8H,14H2 |
InChIKey | LOMMDWBTANPFEJ-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=C3C(=N2)C=CC=C3N |