For research use only. Not for therapeutic Use.
1-Adamantyl methacrylate (Cat No.:M074901) is a chemical compound. It features an adamantane core linked to a methacrylate group, making it valuable in polymer chemistry and materials science. This compound is used as a monomer in the synthesis of polymers with specialized properties, including high glass transition temperatures and steric hindrance. Its rigid and bulky structure imparts unique characteristics to resulting polymers, making them suitable for applications like coatings, adhesives, and optical materials. The compound’s distinct features contribute to its role in tailoring polymer properties for various industrial and research purposes.
Catalog Number | M074901 |
CAS Number | 16887-36-8 |
Molecular Formula | C14H20O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1-adamantyl 2-methylprop-2-enoate |
InChI | InChI=1S/C14H20O2/c1-9(2)13(15)16-14-6-10-3-11(7-14)5-12(4-10)8-14/h10-12H,1,3-8H2,2H3 |
InChIKey | MZVABYGYVXBZDP-UHFFFAOYSA-N |
SMILES | CC(=C)C(=O)OC12CC3CC(C1)CC(C3)C2 |