For research use only. Not for therapeutic Use.
1-Allyl-3-vinylimidazolium bromide (Cat.No:L004201) is a significant compound in the field of organic synthesis. Its distinctive structure, incorporating an imidazolium moiety with allyl and vinyl substituents, imparts unique reactivity and properties. This compound serves as a valuable precursor in the preparation of specialized materials and ionic liquids with potential applications in catalysis and materials science.
CAS Number | 1072788-73-8 |
Molecular Formula | C8H11BrN2 |
Purity | ≥95% |
IUPAC Name | 1-ethenyl-3-prop-2-enylimidazol-3-ium;bromide |
InChI | InChI=1S/C8H11N2.BrH/c1-3-5-10-7-6-9(4-2)8-10;/h3-4,6-8H,1-2,5H2;1H/q+1;/p-1 |
InChIKey | ZPMDZBOORVETFL-UHFFFAOYSA-M |
SMILES | C=CC[N+]1=CN(C=C1)C=C.[Br-] |