For research use only. Not for therapeutic Use.
1-Amino-11-azido-3,6,9-trioxaundecane(Cat No.:R000006) is a chemical compound. It contains an amino group (-NH2) and an azide group (-N3), along with a chain of three oxygen atoms interspersed with carbon atoms. This compound is used in organic synthesis as a bifunctional linker molecule. The azide group can participate in click chemistry reactions, specifically the azide-alkyne cycloaddition reaction, allowing for the attachment of the molecule to other compounds or surfaces. The amino group provides a reactive site for further functionalization or conjugation with biomolecules, making it a valuable tool in chemical biology and materials science.
CAS Number | 134179-38-7 |
Synonyms | 2-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]ethanamine; 11-Azido-3,6,9-trioxaundecan-1-amine |
Molecular Formula | C8H18N4O3 |
Purity | ≥95% |
Target | PROTAC Linkers |
Storage | Desiccate at -20°C |
IUPAC Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanamine |
InChI | InChI=1S/C8H18N4O3/c9-1-3-13-5-7-15-8-6-14-4-2-11-12-10/h1-9H2 |
InChIKey | FPVCVHVTMPCZTH-UHFFFAOYSA-N |
SMILES | C(COCCOCCOCCN=[N+]=[N-])N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |