Home
>
Chemical Reagents>Organic Building Blocks> 1-Amino-3-bromopyridin-1-ium 2,4,6-trimethylbenzene-1-sulfonate
For research use only. Not for therapeutic Use.
1-Amino-3-bromopyridin-1-ium 2,4,6-trimethylbenzene-1-sulfonate(Cat No.:L028063)is an organic salt used in advanced organic synthesis and pharmaceutical research. The compound features a 1-amino-3-bromopyridinium cation paired with a 2,4,6-trimethylbenzene-1-sulfonate anion, providing unique reactivity and stability. This compound is particularly useful as a building block in the synthesis of complex molecules, where the bromopyridinium moiety can undergo various chemical transformations. The sulfonate anion enhances the solubility and reactivity of the compound, making it a valuable intermediate for researchers focused on developing new therapeutic agents and fine chemicals.
Catalog Number | L028063 |
CAS Number | 55899-13-3 |
Molecular Formula | C14H17BrN2O3S |
Purity | ≥95% |
IUPAC Name | 3-bromopyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate |
InChI | InChI=1S/C9H12O3S.C5H6BrN2/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;6-5-2-1-3-8(7)4-5/h4-5H,1-3H3,(H,10,11,12);1-4H,7H2/q;+1/p-1 |
InChIKey | CMDGFAPRZQBXJY-UHFFFAOYSA-M |
SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)[O-])C.C1=CC(=C[N+](=C1)N)Br |