For research use only. Not for therapeutic Use.
1-amino-N, N-dimethylcyclopropane-1-carboxamide(Cat No.:L007767), is a chemical compound with the molecular formula C6H12N2O. It belongs to the class of cyclopropanes, which are three-membered carbon rings. In this compound, a cyclopropane ring is functionalized with an amino group (NH₂) and two methyl groups (CH₃). The presence of the cyclopropane ring imparts unique reactivity and stability to the compound. Chemical derivatives of cyclopropanes often find applications in organic synthesis and medicinal chemistry due to their strained ring structure, which can lead to interesting and valuable chemical transformations.
CAS Number | 1481463-48-2 |
Molecular Formula | C6H12N2O |
Purity | ≥95% |
IUPAC Name | 1-amino-N,N-dimethylcyclopropane-1-carboxamide |
InChI | InChI=1S/C6H12N2O/c1-8(2)5(9)6(7)3-4-6/h3-4,7H2,1-2H3 |
InChIKey | RBXIDMMDVZMZBK-UHFFFAOYSA-N |
SMILES | CN(C)C(=O)C1(CC1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |