For research use only. Not for therapeutic Use.
[1-(Aminomethyl)cyclopropyl]methanol is a small organic compound featuring a cyclopropane ring with an aminomethyl (-CH₂NH₂) and hydroxymethyl (-CH₂OH) group attached to the same carbon. The combination of these polar functional groups with the strained cyclopropane ring structure gives it unique reactivity and biological interest. This compound is commonly used as a building block in drug development and medicinal chemistry, especially for synthesizing compounds targeting neurological pathways or for exploring other bioactive molecule scaffolds.
CAS Number | 45434-02-4 |
Molecular Formula | C5H11NO |
Purity | ≥95% |
IUPAC Name | [1-(aminomethyl)cyclopropyl]methanol |
InChI | InChI=1S/C5H11NO/c6-3-5(4-7)1-2-5/h7H,1-4,6H2 |
InChIKey | KTBPXPGXDDKAGN-UHFFFAOYSA-N |
SMILES | C1CC1(CN)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |