For research use only. Not for therapeutic Use.
1-[(Aminooxy)methyl]-4-(trifluoromethyl)benzene hydrochloride(CAT: L041611) is a high-purity compound widely used in pharmaceutical and chemical research. Featuring an aminooxy group and a trifluoromethyl-substituted benzene core, this compound is a versatile intermediate for synthesizing bioactive molecules and functional materials. Its hydrochloride salt form ensures enhanced stability and solubility, facilitating its use in diverse chemical reactions, including oxime formation and bioconjugation. Ideal for medicinal chemistry and material science, 1-[(Aminooxy)methyl]-4-(trifluoromethyl)benzene hydrochloride supports innovative research and development with consistent performance and reliable reactivity.
Catalog Number | L041611 |
CAS Number | 321574-29-2 |
Molecular Formula | C8H9ClF3NO |
Purity | ≥95% |
IUPAC Name | O-[[4-(trifluoromethyl)phenyl]methyl]hydroxylamine;hydrochloride |
InChI | InChI=1S/C8H8F3NO.ClH/c9-8(10,11)7-3-1-6(2-4-7)5-13-12;/h1-4H,5,12H2;1H |
InChIKey | XLFMFCSFMQLFAY-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CON)C(F)(F)F.Cl |