For research use only. Not for therapeutic Use.
1-[(Ammoniooxy)methyl]-3-methoxybenzene chloride(Cat No.:L020374)is an aromatic compound featuring a methoxy group on a benzene ring, with an ammoniooxy methyl substituent. This compound is commonly used in organic synthesis and pharmaceutical research as an intermediate for the development of biologically active molecules. The presence of both the ammoniooxy group and chloride counterion provides unique reactivity, making it valuable for various chemical transformations, particularly in reactions involving nucleophilic substitutions.
CAS Number | 3839-39-2 |
Molecular Formula | C8H12ClNO2 |
Purity | ≥95% |
IUPAC Name | O-[(3-methoxyphenyl)methyl]hydroxylamine;hydrochloride |
InChI | InChI=1S/C8H11NO2.ClH/c1-10-8-4-2-3-7(5-8)6-11-9;/h2-5H,6,9H2,1H3;1H |
InChIKey | DNGAZMVOQCQJIG-UHFFFAOYSA-N |
SMILES | COC1=CC=CC(=C1)CON.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |