For research use only. Not for therapeutic Use.
1-Azaspiro[4.5]decane-2,4-dione(Cat No.:L007500), is a chemical compound characterized by a unique bicyclic structure containing a spiro (azaspiro) ring system. Its molecular formula describes a cyclic compound with a ketone functional group. This compound is of interest in organic chemistry due to its unusual structure, potentially making it valuable for medicinal and synthetic applications. Researchers study its reactivity and properties to explore its potential biological activities and medicinal uses.
Catalog Number | L007500 |
CAS Number | 91240-06-1 |
Molecular Formula | C9H13NO2 |
Purity | ≥95% |
IUPAC Name | 1-azaspiro[4.5]decane-2,4-dione |
InChI | InChI=1S/C9H13NO2/c11-7-6-8(12)10-9(7)4-2-1-3-5-9/h1-6H2,(H,10,12) |
InChIKey | MXDFJCRFKOBXRO-UHFFFAOYSA-N |
SMILES | C1CCC2(CC1)C(=O)CC(=O)N2 |