For research use only. Not for therapeutic Use.
1-BOC-3-(Formylmethyl)azetidine is a protected azetidine derivative featuring a tert-butyloxycarbonyl (BOC) group and a formylmethyl substituent. This compound is widely used in organic synthesis, particularly in the preparation of bioactive molecules and pharmaceuticals. The BOC group protects the amine during chemical reactions and can be easily removed under mild conditions. Its unique structure, including the azetidine ring, makes it a valuable intermediate in medicinal chemistry for developing compounds with potential therapeutic applications, especially in drug design.
CAS Number | 152537-04-7 |
Molecular Formula | C10H17NO3 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | tert-butyl 3-(2-oxoethyl)azetidine-1-carboxylate |
InChI | InChI=1S/C10H17NO3/c1-10(2,3)14-9(13)11-6-8(7-11)4-5-12/h5,8H,4,6-7H2,1-3H3 |
InChIKey | JWHFSDTYDAIZID-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CC(C1)CC=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |