For research use only. Not for therapeutic Use.
1-Azido-3,6,9-trioxaundecane-11-ol (Cat.No:R001810) is a compound used in the synthesis of various chemicals. Its unique structure, featuring an azido group and a trioxaundecane backbone, makes it valuable in the creation of specialized molecules for research and industrial applications, including drug development and materials science.
CAS Number | 86770-67-4 |
Synonyms | 2-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]ethanol; |
Molecular Formula | C8H17N3O4 |
Purity | ≥95% |
Target | PROTAC Linkers |
Storage | Store at -20°C |
IUPAC Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanol |
InChI | InChI=1S/C8H17N3O4/c9-11-10-1-3-13-5-7-15-8-6-14-4-2-12/h12H,1-8H2 |
InChIKey | MBQYGQMGPFNSAP-UHFFFAOYSA-N |
SMILES | C(COCCOCCOCCO)N=[N+]=[N-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |