For research use only. Not for therapeutic Use.
1-Azidohexaethylene Glycol(CAT: R054701) is a chemical compound containing an azide group (-N3) and a hexaethylene glycol chain. Its mode of action involves being a versatile compound used in bioconjugation and click chemistry reactions. The azide group in 1-Azidohexaethylene Glycol is highly reactive and can be used to attach biomolecules or labels to surfaces or other molecules through click chemistry reactions. This compound finds applications in various fields, such as bioconjugation, drug delivery systems, and materials science. It is particularly useful in creating functionalized surfaces, labeling proteins, and constructing complex molecules.
CAS Number | 86770-69-6 |
Synonyms | 17-azido-3,6,9,12,15-pentaoxaheptadecan-1-ol; 3,6,9,12,15-Pentaoxa-17-azidoheptadecan-1-ol |
Molecular Formula | C12H25N3O6 |
Purity | ≥95% |
Target | Antibody-drug Conjugate/ADC Related |
Storage | -20°C |
IUPAC Name | 2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
InChI | InChI=1S/C12H25N3O6/c13-15-14-1-3-17-5-7-19-9-11-21-12-10-20-8-6-18-4-2-16/h16H,1-12H2 |
InChIKey | DPRULTZUGLDCPZ-UHFFFAOYSA-N |
SMILES | C(COCCOCCOCCOCCOCCO)N=[N+]=[N-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |