For research use only. Not for therapeutic Use.
1-Benzhydrylazetidin-3-ol is a four-membered azetidine ring compound with a benzhydryl group attached at the nitrogen position and a hydroxyl group at the 3-position. This compound is significant in medicinal chemistry and organic synthesis due to its rigid azetidine framework, which influences molecular conformation and biological activity. Its structure allows for versatile chemical modifications, making it useful in the development of bioactive molecules, particularly in pharmaceutical research. 1-Benzhydrylazetidin-3-ol is often explored as a building block or intermediate in the synthesis of complex therapeutic agents, including antibiotics and other drug candidates.
CAS Number | 18621-17-5 |
Synonyms | 1-(Diphenylmethyl)-3-hydroxyazetinide; 1-(Diphenylmethyl)-3-azetidinol; 1-(Diphenylmethyl)-3-azetidinol; NSC 319045; |
Molecular Formula | C16H17NO |
Purity | ≥95% |
Storage | -20 ℃ |
IUPAC Name | 1-benzhydrylazetidin-3-ol |
InChI | InChI=1S/C16H17NO/c18-15-11-17(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16,18H,11-12H2 |
InChIKey | MMAJXKGUZYDTHV-UHFFFAOYSA-N |
SMILES | C1C(CN1C(C2=CC=CC=C2)C3=CC=CC=C3)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |