For research use only. Not for therapeutic Use.
1-Benzosuberone is an organic compound utilized as a key intermediate in pharmaceutical and agrochemical synthesis. Its unique bicyclic structure is valuable in developing anti-inflammatory, anti-cancer, and CNS-active drugs. Known for its stability and reactivity, 1-Benzosuberone enhances the efficiency of chemical reactions, making it essential in producing complex molecular structures in advanced research and industrial applications.
CAS Number | 826-73-3 |
Synonyms | 1-Benzocycloheptanone; 1-Benzosuberanone; 2,3-Benzosuberone; 5-Benzocycloheptanone; 6,7,8,9-Tetrahydro-5H-benzocyclohepten-5-one; 6,7,8,9-Tetrahydrobenzocyclohepten-5-one; 6,7,8,9-Tetrahydro-5H-benzocyclohepten-5-one; Benzo[b]cycloheptan-1-one; Benzo |
Molecular Formula | C11H12O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
InChI | InChI=1S/C11H12O/c12-11-8-4-2-6-9-5-1-3-7-10(9)11/h1,3,5,7H,2,4,6,8H2 |
InChIKey | KWHUHTFXMNQHAA-UHFFFAOYSA-N |
SMILES | C1CCC(=O)C2=CC=CC=C2C1 |