For research use only. Not for therapeutic Use.
1-Benzyl-3-hydroxyindazole (Cat No.:R049103) is a chemical compound. It features an indazole ring substituted with a benzyl group and a hydroxy group. This compound is of interest in pharmaceutical and chemical research due to its potential biological activities and reactivity. Indazole derivatives often exhibit diverse pharmacological properties, making them valuable in drug discovery. The benzyl and hydroxy groups can be modified to create compounds with specific interactions. Its unique structure and potential bioactivity contribute to its role in developing novel molecules with therapeutic potential and advancing chemical knowledge.
CAS Number | 2215-63-6 |
Synonyms | 1,2-Dihydro-1-(phenylmethyl)-3H-indazol-3-one; 1-Benzyl-1,2-dihydro-3H-indazol-3-one; 1-Benzyl-1H-indazol-3-ol; 3-Hydroxy-1-benzyl-1H-indazole; 1-Benzyl-3-indazolone; NSC 247064 |
Molecular Formula | C14H12N2O |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1-benzyl-2H-indazol-3-one |
InChI | InChI=1S/C14H12N2O/c17-14-12-8-4-5-9-13(12)16(15-14)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,17) |
InChIKey | SXPJFDSMKWLOAB-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=O)N2 |