Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-Benzyl-4-methylpiperidin-3-ol
For research use only. Not for therapeutic Use.
1-Benzyl-4-methylpiperidin-3-ol(CAT: L043251), a benzyl-substituted piperidinol derivative, holds significance in pharmaceutical and organic chemistry. Its benzyl and piperidinyl moieties suggest potential interactions with biological targets, making it relevant for drug development. In pharmaceutical research, it could be explored for its effects on receptors or enzymatic pathways, potentially influencing therapeutic pathways. The hydroxyl group adds versatility, allowing for chemical modifications or potential hydrogen bonding interactions. Additionally, its adaptable structure may find applications in material chemistry, potentially contributing to polymers, coatings, or molecules for surface modifications.
Catalog Number | L043251 |
CAS Number | 384338-20-9 |
Molecular Formula | C13H19NO |
Purity | ≥95% |
IUPAC Name | 1-benzyl-4-methylpiperidin-3-ol |
InChI | InChI=1S/C13H19NO/c1-11-7-8-14(10-13(11)15)9-12-5-3-2-4-6-12/h2-6,11,13,15H,7-10H2,1H3 |
InChIKey | QRGQXVUZVXXWAG-UHFFFAOYSA-N |