For research use only. Not for therapeutic Use.
1-Benzyl-5-bromo-1H-indole(CAT: M120728) is a high-purity halogenated indole derivative featuring a bromine atom at the 5-position and a benzyl group at the nitrogen of the indole core. This versatile molecule is a key intermediate in pharmaceutical research and organic synthesis, widely used in the development of bioactive compounds, including kinase inhibitors and heterocyclic frameworks. The bromine substituent enables targeted functionalization through cross-coupling reactions (e.g., Suzuki or Heck), while the benzyl group enhances stability and reactivity for further derivatization. 1-Benzyl-5-bromo-1H-indole is an essential building block for innovative research in medicinal chemistry and material science, supporting precision-driven chemical transformations.
CAS Number | 10075-51-1 |
Molecular Formula | C15H12BrN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-benzyl-5-bromoindole |
InChI | InChI=1S/C15H12BrN/c16-14-6-7-15-13(10-14)8-9-17(15)11-12-4-2-1-3-5-12/h1-10H,11H2 |
InChIKey | AQXJFUYUNHLBGU-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CN2C=CC3=C2C=CC(=C3)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |