For research use only. Not for therapeutic Use.
1-Benzyl-7-azaindole(Cat No.:M095772)is a heterocyclic compound with significant applications in pharmaceutical research and organic synthesis. Featuring an azaindole core with a benzyl group at the 1-position, this compound serves as a crucial building block in the development of bioactive molecules, including kinase inhibitors and other therapeutic agents. Its structure allows for diverse chemical modifications, making it valuable in medicinal chemistry for the design of potential drugs targeting various diseases. Additionally, 1-Benzyl-7-azaindole is used in the synthesis of complex organic compounds and in studies involving heterocyclic chemistry.
CAS Number | 152955-68-5 |
Molecular Formula | C14H12N2 |
Purity | ≥95% |
IUPAC Name | 1-benzylpyrrolo[2,3-b]pyridine |
InChI | InChI=1S/C14H12N2/c1-2-5-12(6-3-1)11-16-10-8-13-7-4-9-15-14(13)16/h1-10H,11H2 |
InChIKey | DBMKVSWIHRGBBC-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CN2C=CC3=C2N=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |