For research use only. Not for therapeutic Use.
(1-Benzylpiperazin-2-yl)methanol(CAT: L000142) is a compound with versatile applications in organic chemistry and pharmaceutical research. Its action mechanism involves serving as a key intermediate for the synthesis of various organic compounds, making it valuable in drug development. In the pharmaceutical sector, it plays a crucial role in the development of pharmaceutical agents, particularly in the context of central nervous system and psychiatric medications.
CAS Number | 476493-27-3 |
Molecular Formula | C12H18N2O |
Purity | ≥95% |
IUPAC Name | (1-benzylpiperazin-2-yl)methanol |
InChI | InChI=1S/C12H18N2O/c15-10-12-8-13-6-7-14(12)9-11-4-2-1-3-5-11/h1-5,12-13,15H,6-10H2 |
InChIKey | MIULIYROIRMPCW-UHFFFAOYSA-N |