For research use only. Not for therapeutic Use.
1-Boc-3-amino-3-(hydroxymethyl)azetidine(Cat No.:L030301)is a high-purity compound used extensively in pharmaceutical research and organic synthesis. This azetidine derivative, featuring a Boc (tert-butyloxycarbonyl) protecting group, is crucial for the selective modification of amino groups during complex molecule synthesis. Its unique structure, with both amino and hydroxymethyl functionalities, makes it valuable for developing bioactive compounds and novel therapeutic agents. 1-Boc-3-amino-3-(hydroxymethyl)azetidine is essential for research focused on optimizing synthetic pathways, providing reliable performance in advanced medicinal chemistry applications.
Catalog Number | L030301 |
CAS Number | 1262411-27-7 |
Molecular Formula | C9H18N2O3 |
Purity | ≥95% |
IUPAC Name | tert-butyl 3-amino-3-(hydroxymethyl)azetidine-1-carboxylate |
InChI | InChI=1S/C9H18N2O3/c1-8(2,3)14-7(13)11-4-9(10,5-11)6-12/h12H,4-6,10H2,1-3H3 |
InChIKey | JWVHLOXEHDYSLW-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CC(C1)(CO)N |