Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-Boc-4-(2-(4-Fluoro-3-(trifluoromethyl)phenyl)-2-oxoethylcarbamoyl)piperidine
For research use only. Not for therapeutic Use.
1-Boc-4-(2-(4-Fluoro-3-(trifluoromethyl)phenyl)-2-oxoethylcarbamoyl)piperidine (Cat No.: L006894) is a synthetic compound with diverse applications. Its action involves N-tert-butoxycarbonyl (Boc) protection of the piperidine nitrogen, ensuring chemoselectivity. Acting as a precursor, its mode of action includes controlled release of the carbamoyl group upon deprotection. Pharmacologically, it demonstrates potential as a building block in organic synthesis, particularly in medicinal chemistry, due to its ability to modify molecular structures. This compound finds applications in the creation of pharmaceutical agents, agrochemicals, and materials for research and development, contributing to advancements in various scientific fields.
CAS Number | 1082949-99-2 |
Molecular Formula | C20H24F4N2O4 |
Purity | ≥95% |
IUPAC Name | tert-butyl 4-[[2-[4-fluoro-3-(trifluoromethyl)phenyl]-2-oxoethyl]carbamoyl]piperidine-1-carboxylate |
InChI | InChI=1S/C20H24F4N2O4/c1-19(2,3)30-18(29)26-8-6-12(7-9-26)17(28)25-11-16(27)13-4-5-15(21)14(10-13)20(22,23)24/h4-5,10,12H,6-9,11H2,1-3H3,(H,25,28) |
InChIKey | QJMZCTXXDQBKAB-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)NCC(=O)C2=CC(=C(C=C2)F)C(F)(F)F |