Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-Boc-4-(2-Methoxyethylamino)piperidine
For research use only. Not for therapeutic Use.
1-Boc-4-(2-Methoxyethylamino)piperidine (Cat No.:L014689) is a chemical compound featuring a piperidine ring with a Boc (tert-butoxycarbonyl) protecting group on the nitrogen atom and a 2-methoxyethylamino group at the 4-position. This versatile compound serves as a valuable building block or intermediate in organic synthesis, particularly in medicinal chemistry and pharmaceutical research. The Boc protecting group safeguards the nitrogen, allowing selective functionalization. The presence of the 2-methoxyethyl amino group enhances its applicability for various synthetic pathways and pharmaceutical development.
CAS Number | 710972-40-0 |
Molecular Formula | C13H26N2O3 |
Purity | ≥95% |
Storage | 2–8 °C |
IUPAC Name | tert-butyl 4-(2-methoxyethylamino)piperidine-1-carboxylate |
InChI | InChI=1S/C13H26N2O3/c1-13(2,3)18-12(16)15-8-5-11(6-9-15)14-7-10-17-4/h11,14H,5-10H2,1-4H3 |
InChIKey | JDQHOQBFYIPISR-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NCCOC |