For research use only. Not for therapeutic Use.
1-Boc-4-dimethylcarbamoylpiperidine(Cat No.:L019973)is a protected piperidine derivative widely used in pharmaceutical and organic synthesis. Featuring a Boc (tert-butoxycarbonyl) protecting group at the nitrogen and a dimethylcarbamoyl group at the 4-position, this compound is valuable as an intermediate in the synthesis of bioactive molecules, including potential therapeutic agents. The Boc group provides stability during chemical reactions, allowing for selective deprotection later in the synthesis. 1-Boc-4-dimethylcarbamoylpiperidine is essential for researchers focused on developing complex organic compounds and advancing medicinal chemistry.
CAS Number | 254905-58-3 |
Molecular Formula | C13H24N2O3 |
Purity | ≥95% |
IUPAC Name | tert-butyl 4-(dimethylcarbamoyl)piperidine-1-carboxylate |
InChI | InChI=1S/C13H24N2O3/c1-13(2,3)18-12(17)15-8-6-10(7-9-15)11(16)14(4)5/h10H,6-9H2,1-5H3 |
InChIKey | VRVUOIHXJJWKIY-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)N(C)C |