Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-Boc-4-fluoro-4-piperidinecarboxylic Acid
For research use only. Not for therapeutic Use.
1-Boc-4-fluoro-4-piperidinecarboxylic acid (Cat No.:L019969) is a chemical compound with a piperidine ring substituted by a 4-fluoro group and a Boc (tert-butoxycarbonyl) protecting group at the carboxylic acid end. This versatile compound serves as a valuable building block or intermediate in organic synthesis and medicinal chemistry. The Boc protecting group shields the carboxylic acid functionality during chemical transformations, facilitating selective reactions. The presence of the 4-fluoro group imparts specific chemical properties, making it useful for various synthetic pathways and potentially in drug development.
CAS Number | 614731-04-3 |
Molecular Formula | C11H18FNO4 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
InChI | InChI=1S/C11H18FNO4/c1-10(2,3)17-9(16)13-6-4-11(12,5-7-13)8(14)15/h4-7H2,1-3H3,(H,14,15) |
InChIKey | NRQOTEPIFSRDMH-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)O)F |