For research use only. Not for therapeutic Use.
1-BOC-6-Bromo-indole-2-boronic acid(Cat No.:M125140)is a high-purity compound commonly used in pharmaceutical research and organic synthesis. This boronic acid derivative, featuring a BOC-protected indole and a bromine atom, is a valuable intermediate in the development of bioactive molecules, particularly in the synthesis of complex heterocyclic compounds. Its unique structure allows for selective reactions, making it essential in medicinal chemistry for creating potential therapeutic agents. 1-BOC-6-Bromo-indole-2-boronic acid offers reliable performance in advanced chemical synthesis and drug discovery research.
CAS Number | 1217500-59-8 |
Molecular Formula | C13H15BBrNO4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | [6-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
InChI | InChI=1S/C13H15BBrNO4/c1-13(2,3)20-12(17)16-10-7-9(15)5-4-8(10)6-11(16)14(18)19/h4-7,18-19H,1-3H3 |
InChIKey | RMYFCWUHNRAJJC-UHFFFAOYSA-N |
SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=C(C=C2)Br)(O)O |