For research use only. Not for therapeutic Use.
1-Bromo-2-chloro-4-fluoro-3-(trifluoromethyl)benzene is a halogenated benzene derivative with bromine, chlorine, and fluorine substituents, along with a trifluoromethyl group at the 3-position. This compound serves as a valuable intermediate in organic synthesis, especially in pharmaceuticals and agrochemical research, due to its unique halogen pattern and trifluoromethyl group, which enhance reactivity and molecular stability. Its structure allows for selective functionalization, making it ideal for creating complex molecules and contributing to efficient synthetic routes in advanced research applications.
CAS Number | 2091146-38-0 |
Molecular Formula | C7H2BrClF4 |
Purity | ≥95% |
IUPAC Name | 1-bromo-2-chloro-4-fluoro-3-(trifluoromethyl)benzene |
InChI | InChI=1S/C7H2BrClF4/c8-3-1-2-4(10)5(6(3)9)7(11,12)13/h1-2H |
InChIKey | GBBYWLYGESLVGZ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1F)C(F)(F)F)Cl)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |