For research use only. Not for therapeutic Use.
1-Bromo-2-fluoro-4-iodobenzene (Cat No.:M115907) is a chemical compound. It consists of a benzene ring substituted with bromine, fluorine, and iodine atoms. This compound is utilized in organic synthesis and materials science for its halogenated aromatic structure. Its unique substitution pattern offers diverse reactivity, making it valuable in building complex molecules. The compound’s role extends to the preparation of functional materials and ligands for transition metal catalysis. Its halogen atoms influence properties and reactivity, contributing to its significance in designing new compounds and materials for various chemical and scientific applications.
CAS Number | 136434-77-0 |
Molecular Formula | C6H3BrFI |
Purity | ≥95% |
Storage | Keep in dark place,Sealed in dry,Room Temperature |
IUPAC Name | 1-bromo-2-fluoro-4-iodobenzene |
InChI | InChI=1S/C6H3BrFI/c7-5-2-1-4(9)3-6(5)8/h1-3H |
InChIKey | OCODJNASCDFXSR-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1I)F)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |